C20H20Cl3NO3S — CID 67570681
4-[6-(2,3,4-trichloro-4-methoxycyclohexa-1,5-dien-1-yl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide (PubChem CID 67570681) has the molecular formula C20H20Cl3NO3S and a molecular weight of 460.81 g/mol. Its IUPAC name is 4-[6-(2,3,4-trichloro-4-methoxycyclohexa-1,5-dien-1-yl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide.
| Compound Name | 4-[6-(2,3,4-trichloro-4-methoxycyclohexa-1,5-dien-1-yl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67570681 |
| Molecular Formula | C20H20Cl3NO3S |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | 4-[6-(2,3,4-trichloro-4-methoxycyclohexa-1,5-dien-1-yl)spiro[2.4]hept-5-en-5-yl]benzenesulfonamide |
| SMILES | COC1(Cl)C=CC(C2=C(c3ccc(S(N)(=O)=O)cc3)CC3(CC3)C2)=C(Cl)C1Cl |
| InChI | InChI=1S/C20H20Cl3NO3S/c1-27-20(23)7-6-14(17(21)18(20)22)16-11-19(8-9-19)10-15(16)12-2-4-13(5-3-12)28(24,25)26/h2-7,18H,8-11H2,1H3,(H2,24,25,26) |
| InChIKey | XDVIYTOMVHJVHF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|