C21H22Cl3NO3S — CID 139746272
[4-[6-(2,4,5-trichloro-4-methoxycyclohexa-1,5-dien-1-yl)spiro[2.4]hept-5-en-5-yl]phenyl]methanesulfonamide (PubChem CID 139746272) has the molecular formula C21H22Cl3NO3S and a molecular weight of 474.84 g/mol. Its IUPAC name is [4-[6-(2,4,5-trichloro-4-methoxycyclohexa-1,5-dien-1-yl)spiro[2.4]hept-5-en-5-yl]phenyl]methanesulfonamide.
| Compound Name | [4-[6-(2,4,5-trichloro-4-methoxycyclohexa-1,5-dien-1-yl)spiro[2.4]hept-5-en-5-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 139746272 |
| Molecular Formula | C21H22Cl3NO3S |
| Molecular Weight | 474.84 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | [4-[6-(2,4,5-trichloro-4-methoxycyclohexa-1,5-dien-1-yl)spiro[2.4]hept-5-en-5-yl]phenyl]methanesulfonamide |
| SMILES | COC1(Cl)CC(Cl)=C(C2=C(c3ccc(CS(N)(=O)=O)cc3)CC3(CC3)C2)C=C1Cl |
| InChI | InChI=1S/C21H22Cl3NO3S/c1-28-21(24)11-18(22)15(8-19(21)23)17-10-20(6-7-20)9-16(17)14-4-2-13(3-5-14)12-29(25,26)27/h2-5,8H,6-7,9-12H2,1H3,(H2,25,26,27) |
| InChIKey | DIPNTYHANSHRDH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|