C22H23FO4S — CID 18933991
6-(3,4-dimethoxyphenyl)-5-[4-(fluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene (PubChem CID 18933991) has the molecular formula C22H23FO4S and a molecular weight of 402.49 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-5-[4-(fluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene.
| Compound Name | 6-(3,4-dimethoxyphenyl)-5-[4-(fluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene |
|---|---|
| PubChem CID | 18933991 |
| Molecular Formula | C22H23FO4S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-5-[4-(fluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene |
| SMILES | COc1ccc(C2=C(c3ccc(S(=O)(=O)CF)cc3)CC3(CC3)C2)cc1OC |
| InChI | InChI=1S/C22H23FO4S/c1-26-20-8-5-16(11-21(20)27-2)19-13-22(9-10-22)12-18(19)15-3-6-17(7-4-15)28(24,25)14-23/h3-8,11H,9-10,12-14H2,1-2H3 |
| InChIKey | RTDVHXIFYXFTTI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|