C23H23ClO7S — CID 11798881
dimethyl 3-(3-chloro-4-methoxyphenyl)-4-(4-methylsulfonylphenyl)cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 11798881) has the molecular formula C23H23ClO7S and a molecular weight of 478.95 g/mol. Its IUPAC name is dimethyl 3-(3-chloro-4-methoxyphenyl)-4-(4-methylsulfonylphenyl)cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(3-chloro-4-methoxyphenyl)-4-(4-methylsulfonylphenyl)cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11798881 |
| Molecular Formula | C23H23ClO7S |
| Molecular Weight | 478.95 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | dimethyl 3-(3-chloro-4-methoxyphenyl)-4-(4-methylsulfonylphenyl)cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2ccc(S(C)(=O)=O)cc2)=C(c2ccc(OC)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H23ClO7S/c1-29-20-10-7-15(11-19(20)24)18-13-23(21(25)30-2,22(26)31-3)12-17(18)14-5-8-16(9-6-14)32(4,27)28/h5-11H,12-13H2,1-4H3 |
| InChIKey | XKQGTRVYEVBXMJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.95 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|