C21H19BrF2O2S — CID 18934042
6-(4-bromo-3-methylphenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene (PubChem CID 18934042) has the molecular formula C21H19BrF2O2S and a molecular weight of 453.35 g/mol. Its IUPAC name is 6-(4-bromo-3-methylphenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene.
| Compound Name | 6-(4-bromo-3-methylphenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene |
|---|---|
| PubChem CID | 18934042 |
| Molecular Formula | C21H19BrF2O2S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 6-(4-bromo-3-methylphenyl)-5-[4-(difluoromethylsulfonyl)phenyl]spiro[2.4]hept-5-ene |
| SMILES | Cc1cc(C2=C(c3ccc(S(=O)(=O)C(F)F)cc3)CC3(CC3)C2)ccc1Br |
| InChI | InChI=1S/C21H19BrF2O2S/c1-13-10-15(4-7-19(13)22)18-12-21(8-9-21)11-17(18)14-2-5-16(6-3-14)27(25,26)20(23)24/h2-7,10,20H,8-9,11-12H2,1H3 |
| InChIKey | FSIMMSYTZVBDAD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|