C20H19F3N2O2S — CID 18933691
4-[7-[6-(trifluoromethyl)-3-pyridinyl]spiro[3.4]oct-6-en-6-yl]benzenesulfonamide (PubChem CID 18933691) has the molecular formula C20H19F3N2O2S and a molecular weight of 408.45 g/mol. Its IUPAC name is 4-[7-[6-(trifluoromethyl)-3-pyridinyl]spiro[3.4]oct-6-en-6-yl]benzenesulfonamide.
| Compound Name | 4-[7-[6-(trifluoromethyl)-3-pyridinyl]spiro[3.4]oct-6-en-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18933691 |
| Molecular Formula | C20H19F3N2O2S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 4-[7-[6-(trifluoromethyl)-3-pyridinyl]spiro[3.4]oct-6-en-6-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C2=C(c3ccc(C(F)(F)F)nc3)CC3(CCC3)C2)cc1 |
| InChI | InChI=1S/C20H19F3N2O2S/c21-20(22,23)18-7-4-14(12-25-18)17-11-19(8-1-9-19)10-16(17)13-2-5-15(6-3-13)28(24,26)27/h2-7,12H,1,8-11H2,(H2,24,26,27) |
| InChIKey | PYQFIFNAGPKXBL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |