C21H19BrClNO4S2 — CID 175280518
ethyl 4-(2-bromoethyl)-5-(4-chlorophenyl)-3-(4-sulfamoylphenyl)thiophene-2-carboxylate (PubChem CID 175280518) has the molecular formula C21H19BrClNO4S2 and a molecular weight of 528.88 g/mol. Its IUPAC name is ethyl 4-(2-bromoethyl)-5-(4-chlorophenyl)-3-(4-sulfamoylphenyl)thiophene-2-carboxylate.
| Compound Name | ethyl 4-(2-bromoethyl)-5-(4-chlorophenyl)-3-(4-sulfamoylphenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 175280518 |
| Molecular Formula | C21H19BrClNO4S2 |
| Molecular Weight | 528.88 g/mol |
| Exact Mass | 526.96 |
| IUPAC Name | ethyl 4-(2-bromoethyl)-5-(4-chlorophenyl)-3-(4-sulfamoylphenyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccc(Cl)cc2)c(CCBr)c1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H19BrClNO4S2/c1-2-28-21(25)20-18(13-5-9-16(10-6-13)30(24,26)27)17(11-12-22)19(29-20)14-3-7-15(23)8-4-14/h3-10H,2,11-12H2,1H3,(H2,24,26,27) |
| InChIKey | TVXVKQNBGJCSRA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.88 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|