C16H12F7NO3S — CID 2308588
ethyl 2-amino-4-(4-fluorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)thiophene-3-carboxylate (PubChem CID 2308588) has the molecular formula C16H12F7NO3S and a molecular weight of 431.33 g/mol. Its IUPAC name is ethyl 2-amino-4-(4-fluorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-4-(4-fluorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2308588 |
| Molecular Formula | C16H12F7NO3S |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | ethyl 2-amino-4-(4-fluorophenyl)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc(C(O)(C(F)(F)F)C(F)(F)F)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H12F7NO3S/c1-2-27-13(25)10-9(7-3-5-8(17)6-4-7)11(28-12(10)24)14(26,15(18,19)20)16(21,22)23/h3-6,26H,2,24H2,1H3 |
| InChIKey | XBQYJXUJGKEFDS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|