C19H25FN2O2S — CID 39079420
ethyl 2-amino-5-[[butyl(methyl)amino]methyl]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 39079420) has the molecular formula C19H25FN2O2S and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl 2-amino-5-[[butyl(methyl)amino]methyl]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-5-[[butyl(methyl)amino]methyl]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 39079420 |
| Molecular Formula | C19H25FN2O2S |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | ethyl 2-amino-5-[[butyl(methyl)amino]methyl]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCCCN(C)Cc1sc(N)c(C(=O)OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN2O2S/c1-4-6-11-22(3)12-15-16(13-7-9-14(20)10-8-13)17(18(21)25-15)19(23)24-5-2/h7-10H,4-6,11-12,21H2,1-3H3 |
| InChIKey | WTYJSXHMJAMYLM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|