C20H28N2O2S — CID 39079592
methyl 2-amino-5-(diethylaminomethyl)-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate (PubChem CID 39079592) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is methyl 2-amino-5-(diethylaminomethyl)-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-amino-5-(diethylaminomethyl)-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 39079592 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | methyl 2-amino-5-(diethylaminomethyl)-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate |
| SMILES | CCN(CC)Cc1sc(N)c(C(=O)OC)c1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O2S/c1-6-22(7-2)12-16-17(18(19(21)25-16)20(23)24-5)15-10-8-14(9-11-15)13(3)4/h8-11,13H,6-7,12,21H2,1-5H3 |
| InChIKey | XMAYHWQVEIBDHD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|