C18H21NO2S — CID 39079184
methyl 2-amino-5-ethyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 39079184) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is methyl 2-amino-5-ethyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | methyl 2-amino-5-ethyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 39079184 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl 2-amino-5-ethyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | CCc1sc(N)c(C(=O)OC)c1-c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H21NO2S/c1-3-14-15(16(17(19)22-14)18(20)21-2)13-9-8-11-6-4-5-7-12(11)10-13/h8-10H,3-7,19H2,1-2H3 |
| InChIKey | HGEJXSAFSWGCJL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|