C17H19FN2O2S — CID 39079628
methyl 2-amino-4-(4-fluorophenyl)-5-(pyrrolidin-1-ylmethyl)thiophene-3-carboxylate (PubChem CID 39079628) has the molecular formula C17H19FN2O2S and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 2-amino-4-(4-fluorophenyl)-5-(pyrrolidin-1-ylmethyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-amino-4-(4-fluorophenyl)-5-(pyrrolidin-1-ylmethyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 39079628 |
| Molecular Formula | C17H19FN2O2S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | methyl 2-amino-4-(4-fluorophenyl)-5-(pyrrolidin-1-ylmethyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N)sc(CN2CCCC2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN2O2S/c1-22-17(21)15-14(11-4-6-12(18)7-5-11)13(23-16(15)19)10-20-8-2-3-9-20/h4-7H,2-3,8-10,19H2,1H3 |
| InChIKey | YJJVQSPYQFKPQJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|