C17H23N3O2S2 — CID 39079738
methyl 2-amino-5-[(4-ethylpiperazin-1-yl)methyl]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 39079738) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is methyl 2-amino-5-[(4-ethylpiperazin-1-yl)methyl]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | methyl 2-amino-5-[(4-ethylpiperazin-1-yl)methyl]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 39079738 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl 2-amino-5-[(4-ethylpiperazin-1-yl)methyl]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCN1CCN(Cc2sc(N)c(C(=O)OC)c2-c2cccs2)CC1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-3-19-6-8-20(9-7-19)11-13-14(12-5-4-10-23-12)15(16(18)24-13)17(21)22-2/h4-5,10H,3,6-9,11,18H2,1-2H3 |
| InChIKey | NTBKZTJGLAJYFM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|