C16H17ClO3S — CID 102392506
methyl 3-(2-chloroethyl)-4-ethyl-6-hydroxy-2-thiophen-2-ylbenzoate (PubChem CID 102392506) has the molecular formula C16H17ClO3S and a molecular weight of 324.83 g/mol. Its IUPAC name is methyl 3-(2-chloroethyl)-4-ethyl-6-hydroxy-2-thiophen-2-ylbenzoate.
| Compound Name | methyl 3-(2-chloroethyl)-4-ethyl-6-hydroxy-2-thiophen-2-ylbenzoate |
|---|---|
| PubChem CID | 102392506 |
| Molecular Formula | C16H17ClO3S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | methyl 3-(2-chloroethyl)-4-ethyl-6-hydroxy-2-thiophen-2-ylbenzoate |
| SMILES | CCc1cc(O)c(C(=O)OC)c(-c2cccs2)c1CCCl |
| InChI | InChI=1S/C16H17ClO3S/c1-3-10-9-12(18)15(16(19)20-2)14(11(10)6-7-17)13-5-4-8-21-13/h4-5,8-9,18H,3,6-7H2,1-2H3 |
| InChIKey | QWRDCOCTJRUMFZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|