C15H16N2O2S — CID 71777880
methyl 2-amino-5-benzyl-4,6-dihydrothieno[2,3-c]pyrrole-3-carboxylate (PubChem CID 71777880) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is methyl 2-amino-5-benzyl-4,6-dihydrothieno[2,3-c]pyrrole-3-carboxylate.
| Compound Name | methyl 2-amino-5-benzyl-4,6-dihydrothieno[2,3-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 71777880 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl 2-amino-5-benzyl-4,6-dihydrothieno[2,3-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(N)sc2c1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C15H16N2O2S/c1-19-15(18)13-11-8-17(9-12(11)20-14(13)16)7-10-5-3-2-4-6-10/h2-6H,7-9,16H2,1H3 |
| InChIKey | YPTSSVCGUIVCCQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|