methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate

C13H16N2O2 — CID 67427058

IUPACmethyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate
SMILESCOC(=O)C1=C(N)CN(Cc2ccccc2)C1
InChIInChI=1S/C13H16N2O2/c1-17-13(16)11-8-15(9-12(11)14)7-10-5-3-2-4-6-10/h2-6H,7-9,14H2,1H3
InChIKeyYYOMMNKTNDZCLP-UHFFFAOYSA-N
MW232.28 g/mol
LogP0.89
Rot. Bonds3

About methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate

methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 67427058) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate
PubChem CID67427058
Molecular FormulaC13H16N2O2
Molecular Weight232.28 g/mol
Exact Mass232.12
IUPAC Namemethyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate
SMILESCOC(=O)C1=C(N)CN(Cc2ccccc2)C1
InChIInChI=1S/C13H16N2O2/c1-17-13(16)11-8-15(9-12(11)14)7-10-5-3-2-4-6-10/h2-6H,7-9,14H2,1H3
InChIKeyYYOMMNKTNDZCLP-UHFFFAOYSA-N
XLogP0.89
TPSA55.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.28
LogP ≤ 50.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate?
The IUPAC name of methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate (CID 67427058) is methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate.
What is the SMILES notation for methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate?
The canonical SMILES for methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate is COC(=O)C1=C(N)CN(Cc2ccccc2)C1.
What is the InChIKey of methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate?
The InChIKey is YYOMMNKTNDZCLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2/c1-17-13(16)11-8-15(9-12(11)14)7-10-5-3-2-4-6-10/h2-6H,7-9,14H2,1H3.
What are the key properties of methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate?
methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate has a molecular weight of 232.28 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-1-benzyl-2,5-dihydropyrrole-3-carboxylate is sourced from PubChem (CID 67427058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).