C24H28N2O4 — CID 101437732
diethyl 1,3-dibenzyl-2,4-dihydropyrimidine-5,6-dicarboxylate (PubChem CID 101437732) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is diethyl 1,3-dibenzyl-2,4-dihydropyrimidine-5,6-dicarboxylate.
| Compound Name | diethyl 1,3-dibenzyl-2,4-dihydropyrimidine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 101437732 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | diethyl 1,3-dibenzyl-2,4-dihydropyrimidine-5,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)N(Cc2ccccc2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H28N2O4/c1-3-29-23(27)21-17-25(15-19-11-7-5-8-12-19)18-26(22(21)24(28)30-4-2)16-20-13-9-6-10-14-20/h5-14H,3-4,15-18H2,1-2H3 |
| InChIKey | DLAVUGMZTINFEP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |