C23H28N2O2 — CID 118691430
ethyl 1-benzyl-4-[4-(dimethylamino)phenyl]-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 118691430) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl 1-benzyl-4-[4-(dimethylamino)phenyl]-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl 1-benzyl-4-[4-(dimethylamino)phenyl]-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 118691430 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | ethyl 1-benzyl-4-[4-(dimethylamino)phenyl]-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(N(C)C)cc2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H28N2O2/c1-4-27-23(26)22-17-25(16-18-8-6-5-7-9-18)15-14-21(22)19-10-12-20(13-11-19)24(2)3/h5-13H,4,14-17H2,1-3H3 |
| InChIKey | DFCXGWHQCUEGGF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|