C16H18O5S — CID 11450116
ethyl 5-butanoyl-4,7-dihydroxy-3-methyl-1-benzothiophene-2-carboxylate (PubChem CID 11450116) has the molecular formula C16H18O5S and a molecular weight of 322.38 g/mol. Its IUPAC name is ethyl 5-butanoyl-4,7-dihydroxy-3-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-butanoyl-4,7-dihydroxy-3-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 11450116 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | ethyl 5-butanoyl-4,7-dihydroxy-3-methyl-1-benzothiophene-2-carboxylate |
| SMILES | CCCC(=O)c1cc(O)c2sc(C(=O)OCC)c(C)c2c1O |
| InChI | InChI=1S/C16H18O5S/c1-4-6-10(17)9-7-11(18)15-12(13(9)19)8(3)14(22-15)16(20)21-5-2/h7,18-19H,4-6H2,1-3H3 |
| InChIKey | VQVWQRVXOCDUMN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|