C15H20O6S — CID 13321436
diethyl 3-butanoyloxy-4-methylthiophene-2,5-dicarboxylate (PubChem CID 13321436) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is diethyl 3-butanoyloxy-4-methylthiophene-2,5-dicarboxylate.
| Compound Name | diethyl 3-butanoyloxy-4-methylthiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 13321436 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | diethyl 3-butanoyloxy-4-methylthiophene-2,5-dicarboxylate |
| SMILES | CCCC(=O)Oc1c(C(=O)OCC)sc(C(=O)OCC)c1C |
| InChI | InChI=1S/C15H20O6S/c1-5-8-10(16)21-11-9(4)12(14(17)19-6-2)22-13(11)15(18)20-7-3/h5-8H2,1-4H3 |
| InChIKey | RHYNMGTVBBHSDD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |