C18H16O6S2 — CID 102379316
diethyl 3,5-dimethyl-4,8-dioxothieno[3,2-f][1]benzothiole-2,6-dicarboxylate (PubChem CID 102379316) has the molecular formula C18H16O6S2 and a molecular weight of 392.45 g/mol. Its IUPAC name is diethyl 3,5-dimethyl-4,8-dioxothieno[3,2-f][1]benzothiole-2,6-dicarboxylate.
| Compound Name | diethyl 3,5-dimethyl-4,8-dioxothieno[3,2-f][1]benzothiole-2,6-dicarboxylate |
|---|---|
| PubChem CID | 102379316 |
| Molecular Formula | C18H16O6S2 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | diethyl 3,5-dimethyl-4,8-dioxothieno[3,2-f][1]benzothiole-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1sc2c(c1C)C(=O)c1c(sc(C(=O)OCC)c1C)C2=O |
| InChI | InChI=1S/C18H16O6S2/c1-5-23-17(21)13-7(3)9-11(19)10-8(4)14(18(22)24-6-2)26-16(10)12(20)15(9)25-13/h5-6H2,1-4H3 |
| InChIKey | NKYWUUCJOKKORY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|