ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate

C9H11ClO4S2 — CID 166081846

IUPACethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate
SMILESCCOC(=O)c1sc(C)c(C)c1S(=O)(=O)Cl
InChIInChI=1S/C9H11ClO4S2/c1-4-14-9(11)7-8(16(10,12)13)5(2)6(3)15-7/h4H2,1-3H3
InChIKeyKYKKGGIFYWHASN-UHFFFAOYSA-N
MW282.77 g/mol
LogP2.47
Rot. Bonds3

About ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate

ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate (PubChem CID 166081846) has the molecular formula C9H11ClO4S2 and a molecular weight of 282.77 g/mol. Its IUPAC name is ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate.

Molecular Properties

Compound Nameethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate
PubChem CID166081846
Molecular FormulaC9H11ClO4S2
Molecular Weight282.77 g/mol
Exact Mass281.98
IUPAC Nameethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate
SMILESCCOC(=O)c1sc(C)c(C)c1S(=O)(=O)Cl
InChIInChI=1S/C9H11ClO4S2/c1-4-14-9(11)7-8(16(10,12)13)5(2)6(3)15-7/h4H2,1-3H3
InChIKeyKYKKGGIFYWHASN-UHFFFAOYSA-N
XLogP2.47
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.77
LogP ≤ 52.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate?
The IUPAC name of ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate (CID 166081846) is ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate.
What is the SMILES notation for ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate?
The canonical SMILES for ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate is CCOC(=O)c1sc(C)c(C)c1S(=O)(=O)Cl.
What is the InChIKey of ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate?
The InChIKey is KYKKGGIFYWHASN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO4S2/c1-4-14-9(11)7-8(16(10,12)13)5(2)6(3)15-7/h4H2,1-3H3.
What are the key properties of ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate?
ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate has a molecular weight of 282.77 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate is sourced from PubChem (CID 166081846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).