About ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate
ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate (PubChem CID 166081846) has the molecular formula C9H11ClO4S2
and a molecular weight of 282.77 g/mol. Its IUPAC name is ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate.
Analyze ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate?
The IUPAC name of ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate (CID 166081846) is ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate.
What is the SMILES notation for ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate?
The canonical SMILES for ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate is CCOC(=O)c1sc(C)c(C)c1S(=O)(=O)Cl.
What is the InChIKey of ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate?
The InChIKey is KYKKGGIFYWHASN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO4S2/c1-4-14-9(11)7-8(16(10,12)13)5(2)6(3)15-7/h4H2,1-3H3.
What are the key properties of ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate?
ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate has a molecular weight of 282.77 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-chlorosulfonyl-4,5-dimethylthiophene-2-carboxylate is sourced from PubChem (CID 166081846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).