About diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate
diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate (PubChem CID 101263964) has the molecular formula C12H17NO4S
and a molecular weight of 271.34 g/mol. Its IUPAC name is diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate.
Analyze diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate?
The IUPAC name of diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate (CID 101263964) is diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate.
What is the SMILES notation for diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate?
The canonical SMILES for diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate is CCOC(=O)c1sc(NC)c(C)c1C(=O)OCC.
What is the InChIKey of diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate?
The InChIKey is WFZCANCSWIAWNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4S/c1-5-16-11(14)8-7(3)10(13-4)18-9(8)12(15)17-6-2/h13H,5-6H2,1-4H3.
What are the key properties of diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate?
diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate has a molecular weight of 271.34 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-methyl-5-(methylamino)thiophene-2,3-dicarboxylate is sourced from PubChem (CID 101263964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).