C9H11N3O2S — CID 103424239
ethyl 3-amino-4-cyano-5-(methylamino)thiophene-2-carboxylate (PubChem CID 103424239) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is ethyl 3-amino-4-cyano-5-(methylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-cyano-5-(methylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103424239 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | ethyl 3-amino-4-cyano-5-(methylamino)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC)c(C#N)c1N |
| InChI | InChI=1S/C9H11N3O2S/c1-3-14-9(13)7-6(11)5(4-10)8(12-2)15-7/h12H,3,11H2,1-2H3 |
| InChIKey | YDLRYCBJQLGSPP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |