C12H15N3O2S — CID 103507365
ethyl 3-amino-4-cyano-5-(2-methylprop-2-enylamino)thiophene-2-carboxylate (PubChem CID 103507365) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is ethyl 3-amino-4-cyano-5-(2-methylprop-2-enylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-cyano-5-(2-methylprop-2-enylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103507365 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl 3-amino-4-cyano-5-(2-methylprop-2-enylamino)thiophene-2-carboxylate |
| SMILES | C=C(C)CNc1sc(C(=O)OCC)c(N)c1C#N |
| InChI | InChI=1S/C12H15N3O2S/c1-4-17-12(16)10-9(14)8(5-13)11(18-10)15-6-7(2)3/h15H,2,4,6,14H2,1,3H3 |
| InChIKey | LUEDVWXOLYQSNE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|