C15H21N3O2S — CID 107416210
ethyl 3-amino-4-cyano-5-[(3-methylcyclopentyl)methylamino]thiophene-2-carboxylate (PubChem CID 107416210) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is ethyl 3-amino-4-cyano-5-[(3-methylcyclopentyl)methylamino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-cyano-5-[(3-methylcyclopentyl)methylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 107416210 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | ethyl 3-amino-4-cyano-5-[(3-methylcyclopentyl)methylamino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NCC2CCC(C)C2)c(C#N)c1N |
| InChI | InChI=1S/C15H21N3O2S/c1-3-20-15(19)13-12(17)11(7-16)14(21-13)18-8-10-5-4-9(2)6-10/h9-10,18H,3-6,8,17H2,1-2H3 |
| InChIKey | QKVKJWDMIOEGLO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |