C13H19N3O3S — CID 103508205
ethyl 3-amino-4-cyano-5-(1-methoxybutan-2-ylamino)thiophene-2-carboxylate (PubChem CID 103508205) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is ethyl 3-amino-4-cyano-5-(1-methoxybutan-2-ylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-4-cyano-5-(1-methoxybutan-2-ylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103508205 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | ethyl 3-amino-4-cyano-5-(1-methoxybutan-2-ylamino)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(CC)COC)c(C#N)c1N |
| InChI | InChI=1S/C13H19N3O3S/c1-4-8(7-18-3)16-12-9(6-14)10(15)11(20-12)13(17)19-5-2/h8,16H,4-5,7,15H2,1-3H3 |
| InChIKey | DWZGYUDAJUWJMN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |