C12H21N3O4S2 — CID 103508194
3-amino-5-(1-methoxybutan-2-ylamino)-N-methyl-4-methylsulfonylthiophene-2-carboxamide (PubChem CID 103508194) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-amino-5-(1-methoxybutan-2-ylamino)-N-methyl-4-methylsulfonylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(1-methoxybutan-2-ylamino)-N-methyl-4-methylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103508194 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-amino-5-(1-methoxybutan-2-ylamino)-N-methyl-4-methylsulfonylthiophene-2-carboxamide |
| SMILES | CCC(COC)Nc1sc(C(=O)NC)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C12H21N3O4S2/c1-5-7(6-19-3)15-12-10(21(4,17)18)8(13)9(20-12)11(16)14-2/h7,15H,5-6,13H2,1-4H3,(H,14,16) |
| InChIKey | LZBYLVPNKZSDFI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |