C12H14N2O3S — CID 112724737
butyl 5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 112724737) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is butyl 5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | butyl 5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 112724737 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | butyl 5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCCCOC(=O)c1sc2nc[nH]c(=O)c2c1C |
| InChI | InChI=1S/C12H14N2O3S/c1-3-4-5-17-12(16)9-7(2)8-10(15)13-6-14-11(8)18-9/h6H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | YXIVBXOUMHKBOI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|