C22H24N2O6S — CID 23410837
2-phenoxyethyl 3-(2-butoxy-2-oxoethyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 23410837) has the molecular formula C22H24N2O6S and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-phenoxyethyl 3-(2-butoxy-2-oxoethyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-phenoxyethyl 3-(2-butoxy-2-oxoethyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 23410837 |
| Molecular Formula | C22H24N2O6S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-phenoxyethyl 3-(2-butoxy-2-oxoethyl)-5-methyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCCCOC(=O)Cn1cnc2sc(C(=O)OCCOc3ccccc3)c(C)c2c1=O |
| InChI | InChI=1S/C22H24N2O6S/c1-3-4-10-29-17(25)13-24-14-23-20-18(21(24)26)15(2)19(31-20)22(27)30-12-11-28-16-8-6-5-7-9-16/h5-9,14H,3-4,10-13H2,1-2H3 |
| InChIKey | WIHJGAITKNMHRW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|