C30H24N2O5S — CID 20999160
2-phenoxyethyl 5-methyl-4-oxo-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 20999160) has the molecular formula C30H24N2O5S and a molecular weight of 524.60 g/mol. Its IUPAC name is 2-phenoxyethyl 5-methyl-4-oxo-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-phenoxyethyl 5-methyl-4-oxo-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 20999160 |
| Molecular Formula | C30H24N2O5S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-phenoxyethyl 5-methyl-4-oxo-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1c(C(=O)OCCOc2ccccc2)sc2ncn(CC(=O)c3ccc(-c4ccccc4)cc3)c(=O)c12 |
| InChI | InChI=1S/C30H24N2O5S/c1-20-26-28(38-27(20)30(35)37-17-16-36-24-10-6-3-7-11-24)31-19-32(29(26)34)18-25(33)23-14-12-22(13-15-23)21-8-4-2-5-9-21/h2-15,19H,16-18H2,1H3 |
| InChIKey | YSVSCIZQJUDSSK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|