C16H21N3O4S — CID 23410962
hexyl 2-(6-carbamoyl-5-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate (PubChem CID 23410962) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is hexyl 2-(6-carbamoyl-5-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate.
| Compound Name | hexyl 2-(6-carbamoyl-5-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate |
|---|---|
| PubChem CID | 23410962 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | hexyl 2-(6-carbamoyl-5-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl)acetate |
| SMILES | CCCCCCOC(=O)Cn1cnc2sc(C(N)=O)c(C)c2c1=O |
| InChI | InChI=1S/C16H21N3O4S/c1-3-4-5-6-7-23-11(20)8-19-9-18-15-12(16(19)22)10(2)13(24-15)14(17)21/h9H,3-8H2,1-2H3,(H2,17,21) |
| InChIKey | ODBRIGATKSHMCJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|