C22H22N2O2S — CID 168514563
ethyl 4-phenyl-2-(3-pyrrolidin-1-ylphenyl)-1,3-thiazole-5-carboxylate (PubChem CID 168514563) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is ethyl 4-phenyl-2-(3-pyrrolidin-1-ylphenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-phenyl-2-(3-pyrrolidin-1-ylphenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 168514563 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | ethyl 4-phenyl-2-(3-pyrrolidin-1-ylphenyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2cccc(N3CCCC3)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H22N2O2S/c1-2-26-22(25)20-19(16-9-4-3-5-10-16)23-21(27-20)17-11-8-12-18(15-17)24-13-6-7-14-24/h3-5,8-12,15H,2,6-7,13-14H2,1H3 |
| InChIKey | DUUGPRZUCDUNBE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |