C23H17NO4S — CID 169334734
ethyl 2-[3-(5-formylfuran-2-yl)phenyl]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 169334734) has the molecular formula C23H17NO4S and a molecular weight of 403.46 g/mol. Its IUPAC name is ethyl 2-[3-(5-formylfuran-2-yl)phenyl]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[3-(5-formylfuran-2-yl)phenyl]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 169334734 |
| Molecular Formula | C23H17NO4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | ethyl 2-[3-(5-formylfuran-2-yl)phenyl]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2cccc(-c3ccc(C=O)o3)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H17NO4S/c1-2-27-23(26)21-20(15-7-4-3-5-8-15)24-22(29-21)17-10-6-9-16(13-17)19-12-11-18(14-25)28-19/h3-14H,2H2,1H3 |
| InChIKey | RTEGDYXMOMTUOM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|