C21H18N4O2S2 — CID 169363309
ethyl 2-[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 169363309) has the molecular formula C21H18N4O2S2 and a molecular weight of 422.54 g/mol. Its IUPAC name is ethyl 2-[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 169363309 |
| Molecular Formula | C21H18N4O2S2 |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | ethyl 2-[3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2cccc(/N=C(/NC#N)SC)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H18N4O2S2/c1-3-27-20(26)18-17(14-8-5-4-6-9-14)25-19(29-18)15-10-7-11-16(12-15)24-21(28-2)23-13-22/h4-12H,3H2,1-2H3,(H,23,24) |
| InChIKey | ABOFFRJFKOKWPP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|