C38H24N4O8S2 — CID 146183998
ethyl 2-[13-(5-ethoxycarbonyl-4-phenyl-1,3-thiazol-2-yl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 146183998) has the molecular formula C38H24N4O8S2 and a molecular weight of 728.76 g/mol. Its IUPAC name is ethyl 2-[13-(5-ethoxycarbonyl-4-phenyl-1,3-thiazol-2-yl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[13-(5-ethoxycarbonyl-4-phenyl-1,3-thiazol-2-yl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 146183998 |
| Molecular Formula | C38H24N4O8S2 |
| Molecular Weight | 728.76 g/mol |
| Exact Mass | 728.10 |
| IUPAC Name | ethyl 2-[13-(5-ethoxycarbonyl-4-phenyl-1,3-thiazol-2-yl)-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2nc(-c3ccccc3)c(C(=O)OCC)s2)C4=O)nc1-c1ccccc1 |
| InChI | InChI=1S/C38H24N4O8S2/c1-3-49-35(47)29-27(19-11-7-5-8-12-19)39-37(51-29)41-31(43)21-15-17-23-26-24(18-16-22(25(21)26)32(41)44)34(46)42(33(23)45)38-40-28(20-13-9-6-10-14-20)30(52-38)36(48)50-4-2/h5-18H,3-4H2,1-2H3 |
| InChIKey | RDMKSUQIGQCZJM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 153.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.76 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|