C15H16N2O2 — CID 21355157
1,12-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-3,5,7-triene-11,17-dione (PubChem CID 21355157) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1,12-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-3,5,7-triene-11,17-dione.
| Compound Name | 1,12-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-3,5,7-triene-11,17-dione |
|---|---|
| PubChem CID | 21355157 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1,12-diazatetracyclo[8.7.0.03,8.012,16]heptadeca-3,5,7-triene-11,17-dione |
| SMILES | O=C1C2Cc3ccccc3CN2C(=O)C2CCCN12 |
| InChI | InChI=1S/C15H16N2O2/c18-14-12-6-3-7-16(12)15(19)13-8-10-4-1-2-5-11(10)9-17(13)14/h1-2,4-5,12-13H,3,6-9H2 |
| InChIKey | VYQQGNXYGLHQQT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |