C16H9NO4 — CID 10989576
5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(19),2,4(8),9,15,17-hexaene-13,14-dione (PubChem CID 10989576) has the molecular formula C16H9NO4 and a molecular weight of 279.25 g/mol. Its IUPAC name is 5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(19),2,4(8),9,15,17-hexaene-13,14-dione.
| Compound Name | 5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(19),2,4(8),9,15,17-hexaene-13,14-dione |
|---|---|
| PubChem CID | 10989576 |
| Molecular Formula | C16H9NO4 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-1(19),2,4(8),9,15,17-hexaene-13,14-dione |
| SMILES | O=C1C(=O)N2Cc3cc4c(cc3-c3cccc1c32)OCO4 |
| InChI | InChI=1S/C16H9NO4/c18-15-10-3-1-2-9-11-5-13-12(20-7-21-13)4-8(11)6-17(14(9)10)16(15)19/h1-5H,6-7H2 |
| InChIKey | RCQFTENRAHBTTI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|