C11H8N2O3 — CID 102283248
4,6-dioxa-12,14-diazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),8,10-tetraen-13-one (PubChem CID 102283248) has the molecular formula C11H8N2O3 and a molecular weight of 216.20 g/mol. Its IUPAC name is 4,6-dioxa-12,14-diazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),8,10-tetraen-13-one.
| Compound Name | 4,6-dioxa-12,14-diazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),8,10-tetraen-13-one |
|---|---|
| PubChem CID | 102283248 |
| Molecular Formula | C11H8N2O3 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4,6-dioxa-12,14-diazatetracyclo[7.6.0.03,7.010,14]pentadeca-1,3(7),8,10-tetraen-13-one |
| SMILES | O=c1[nH]cc2n1Cc1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C11H8N2O3/c14-11-12-3-8-7-2-10-9(15-5-16-10)1-6(7)4-13(8)11/h1-3H,4-5H2,(H,12,14) |
| InChIKey | VHUZPYKDKCSJQX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |