C15H7NaO7S — CID 23701853
sodium 2-carboxy-9,10-dioxoanthracene-1-sulfonate (PubChem CID 23701853) has the molecular formula C15H7NaO7S and a molecular weight of 354.27 g/mol. Its IUPAC name is sodium 2-carboxy-9,10-dioxoanthracene-1-sulfonate.
| Compound Name | sodium 2-carboxy-9,10-dioxoanthracene-1-sulfonate |
|---|---|
| PubChem CID | 23701853 |
| Molecular Formula | C15H7NaO7S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | sodium 2-carboxy-9,10-dioxoanthracene-1-sulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(C(=O)O)c2S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H8O7S.Na/c16-12-7-3-1-2-4-8(7)13(17)11-9(12)5-6-10(15(18)19)14(11)23(20,21)22;/h1-6H,(H,18,19)(H,20,21,22);/q;+1/p-1 |
| InChIKey | WUCHGMBRYBOPJW-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|