C28H19NO5S — CID 5294664
1-(benzenesulfonyl)-N-benzyl-9,10-dioxoanthracene-2-carboxamide (PubChem CID 5294664) has the molecular formula C28H19NO5S and a molecular weight of 481.53 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-benzyl-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-benzyl-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 5294664 |
| Molecular Formula | C28H19NO5S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 1-(benzenesulfonyl)-N-benzyl-9,10-dioxoanthracene-2-carboxamide |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(C(=O)NCc1ccccc1)c2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H19NO5S/c30-25-20-13-7-8-14-21(20)26(31)24-22(25)15-16-23(28(32)29-17-18-9-3-1-4-10-18)27(24)35(33,34)19-11-5-2-6-12-19/h1-16H,17H2,(H,29,32) |
| InChIKey | MZEPLVVLXIIZJB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|