C17H13BrN2O3S2 — CID 24821752
2-(benzenesulfonyl)-N-benzyl-4-bromo-1,3-thiazole-5-carboxamide (PubChem CID 24821752) has the molecular formula C17H13BrN2O3S2 and a molecular weight of 437.34 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-benzyl-4-bromo-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(benzenesulfonyl)-N-benzyl-4-bromo-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24821752 |
| Molecular Formula | C17H13BrN2O3S2 |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | 2-(benzenesulfonyl)-N-benzyl-4-bromo-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1sc(S(=O)(=O)c2ccccc2)nc1Br |
| InChI | InChI=1S/C17H13BrN2O3S2/c18-15-14(16(21)19-11-12-7-3-1-4-8-12)24-17(20-15)25(22,23)13-9-5-2-6-10-13/h1-10H,11H2,(H,19,21) |
| InChIKey | ADYNBBHCVONSPY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |