C19H14BrN3O2S — CID 24822016
2-(1-benzofuran-5-ylamino)-N-benzyl-4-bromo-1,3-thiazole-5-carboxamide (PubChem CID 24822016) has the molecular formula C19H14BrN3O2S and a molecular weight of 428.31 g/mol. Its IUPAC name is 2-(1-benzofuran-5-ylamino)-N-benzyl-4-bromo-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(1-benzofuran-5-ylamino)-N-benzyl-4-bromo-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 24822016 |
| Molecular Formula | C19H14BrN3O2S |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 2-(1-benzofuran-5-ylamino)-N-benzyl-4-bromo-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1sc(Nc2ccc3occc3c2)nc1Br |
| InChI | InChI=1S/C19H14BrN3O2S/c20-17-16(18(24)21-11-12-4-2-1-3-5-12)26-19(23-17)22-14-6-7-15-13(10-14)8-9-25-15/h1-10H,11H2,(H,21,24)(H,22,23) |
| InChIKey | ZLCKZINXYIPOMU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |