C14H9O10S2- — CID 22352749
3,4-dicarboxy-2-(2-sulfophenyl)benzenesulfonate (PubChem CID 22352749) has the molecular formula C14H9O10S2- and a molecular weight of 401.35 g/mol. Its IUPAC name is 3,4-dicarboxy-2-(2-sulfophenyl)benzenesulfonate.
| Compound Name | 3,4-dicarboxy-2-(2-sulfophenyl)benzenesulfonate |
|---|---|
| PubChem CID | 22352749 |
| Molecular Formula | C14H9O10S2- |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 3,4-dicarboxy-2-(2-sulfophenyl)benzenesulfonate |
| SMILES | O=C(O)c1ccc(S(=O)(=O)[O-])c(-c2ccccc2S(=O)(=O)O)c1C(=O)O |
| InChI | InChI=1S/C14H10O10S2/c15-13(16)8-5-6-10(26(22,23)24)11(12(8)14(17)18)7-3-1-2-4-9(7)25(19,20)21/h1-6H,(H,15,16)(H,17,18)(H,19,20,21)(H,22,23,24)/p-1 |
| InChIKey | OYJGYKYLCVMSFW-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 186.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|