C8H5BrO7S — CID 151393529
3-bromo-4-sulfophthalic acid (PubChem CID 151393529) has the molecular formula C8H5BrO7S and a molecular weight of 325.09 g/mol. Its IUPAC name is 3-bromo-4-sulfophthalic acid.
| Compound Name | 3-bromo-4-sulfophthalic acid |
|---|---|
| PubChem CID | 151393529 |
| Molecular Formula | C8H5BrO7S |
| Molecular Weight | 325.09 g/mol |
| Exact Mass | 323.89 |
| IUPAC Name | 3-bromo-4-sulfophthalic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)c(Br)c1C(=O)O |
| InChI | InChI=1S/C8H5BrO7S/c9-6-4(17(14,15)16)2-1-3(7(10)11)5(6)8(12)13/h1-2H,(H,10,11)(H,12,13)(H,14,15,16) |
| InChIKey | OUYOBSKKLUAOLI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.09 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|