About potassium;hydride;4-iodo-2-sulfobenzoic acid
potassium;hydride;4-iodo-2-sulfobenzoic acid (PubChem CID 173191669) has the molecular formula C7H6IKO5S
and a molecular weight of 368.19 g/mol. Its IUPAC name is potassium;hydride;4-iodo-2-sulfobenzoic acid.
Molecular Properties
| Compound Name | potassium;hydride;4-iodo-2-sulfobenzoic acid |
| PubChem CID | 173191669 |
| Molecular Formula | C7H6IKO5S |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.86 |
| IUPAC Name | potassium;hydride;4-iodo-2-sulfobenzoic acid |
| SMILES | O=C(O)c1ccc(I)cc1S(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C7H5IO5S.K.H/c8-4-1-2-5(7(9)10)6(3-4)14(11,12)13;;/h1-3H,(H,9,10)(H,11,12,13);;/q;+1;-1 |
| InChIKey | UXCKNNPPQLFJCU-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;4-iodo-2-sulfobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;4-iodo-2-sulfobenzoic acid?
The IUPAC name of potassium;hydride;4-iodo-2-sulfobenzoic acid (CID 173191669) is potassium;hydride;4-iodo-2-sulfobenzoic acid.
What is the SMILES notation for potassium;hydride;4-iodo-2-sulfobenzoic acid?
The canonical SMILES for potassium;hydride;4-iodo-2-sulfobenzoic acid is O=C(O)c1ccc(I)cc1S(=O)(=O)O.[H-].[K+].
What is the InChIKey of potassium;hydride;4-iodo-2-sulfobenzoic acid?
The InChIKey is UXCKNNPPQLFJCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IO5S.K.H/c8-4-1-2-5(7(9)10)6(3-4)14(11,12)13;;/h1-3H,(H,9,10)(H,11,12,13);;/q;+1;-1.
What are the key properties of potassium;hydride;4-iodo-2-sulfobenzoic acid?
potassium;hydride;4-iodo-2-sulfobenzoic acid has a molecular weight of 368.19 g/mol, XLogP of -1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;4-iodo-2-sulfobenzoic acid is sourced from PubChem (CID 173191669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).