C14H8K2O10S2 — CID 141467983
dipotassium;4-(4-carboxylato-3-sulfophenyl)-2-sulfobenzoate (PubChem CID 141467983) has the molecular formula C14H8K2O10S2 and a molecular weight of 478.54 g/mol. Its IUPAC name is dipotassium;4-(4-carboxylato-3-sulfophenyl)-2-sulfobenzoate.
| Compound Name | dipotassium;4-(4-carboxylato-3-sulfophenyl)-2-sulfobenzoate |
|---|---|
| PubChem CID | 141467983 |
| Molecular Formula | C14H8K2O10S2 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 477.88 |
| IUPAC Name | dipotassium;4-(4-carboxylato-3-sulfophenyl)-2-sulfobenzoate |
| SMILES | O=C([O-])c1ccc(-c2ccc(C(=O)[O-])c(S(=O)(=O)O)c2)cc1S(=O)(=O)O.[K+].[K+] |
| InChI | InChI=1S/C14H10O10S2.2K/c15-13(16)9-3-1-7(5-11(9)25(19,20)21)8-2-4-10(14(17)18)12(6-8)26(22,23)24;;/h1-6H,(H,15,16)(H,17,18)(H,19,20,21)(H,22,23,24);;/q;2*+1/p-2 |
| InChIKey | JVQBTJFKIMLJPY-UHFFFAOYSA-L |
| XLogP | -7.42 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | -7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|