C18H13Cl2NO3 — CID 168514644
2,3-dichloro-1-hydroxy-4-pyrrolidin-1-ylanthracene-9,10-dione (PubChem CID 168514644) has the molecular formula C18H13Cl2NO3 and a molecular weight of 362.21 g/mol. Its IUPAC name is 2,3-dichloro-1-hydroxy-4-pyrrolidin-1-ylanthracene-9,10-dione.
| Compound Name | 2,3-dichloro-1-hydroxy-4-pyrrolidin-1-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 168514644 |
| Molecular Formula | C18H13Cl2NO3 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2,3-dichloro-1-hydroxy-4-pyrrolidin-1-ylanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(O)c(Cl)c(Cl)c2N1CCCC1 |
| InChI | InChI=1S/C18H13Cl2NO3/c19-13-14(20)18(24)12-11(15(13)21-7-3-4-8-21)16(22)9-5-1-2-6-10(9)17(12)23/h1-2,5-6,24H,3-4,7-8H2 |
| InChIKey | RTXAVNBQVKIQHW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|