C16H13ClNO4- — CID 6956968
1-(3-chloro-1,4-dioxonaphthalen-2-yl)piperidine-4-carboxylate (PubChem CID 6956968) has the molecular formula C16H13ClNO4- and a molecular weight of 318.74 g/mol. Its IUPAC name is 1-(3-chloro-1,4-dioxonaphthalen-2-yl)piperidine-4-carboxylate.
| Compound Name | 1-(3-chloro-1,4-dioxonaphthalen-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 6956968 |
| Molecular Formula | C16H13ClNO4- |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-(3-chloro-1,4-dioxonaphthalen-2-yl)piperidine-4-carboxylate |
| SMILES | O=C1C(Cl)=C(N2CCC(C(=O)[O-])CC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H14ClNO4/c17-12-13(18-7-5-9(6-8-18)16(21)22)15(20)11-4-2-1-3-10(11)14(12)19/h1-4,9H,5-8H2,(H,21,22)/p-1 |
| InChIKey | IDNPIBRUVOVNQA-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|