C20H22LiNO2 — CID 155146392
lithium 1-(2,2-diphenylethyl)piperidine-4-carboxylate (PubChem CID 155146392) has the molecular formula C20H22LiNO2 and a molecular weight of 315.34 g/mol. Its IUPAC name is lithium 1-(2,2-diphenylethyl)piperidine-4-carboxylate.
| Compound Name | lithium 1-(2,2-diphenylethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 155146392 |
| Molecular Formula | C20H22LiNO2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | lithium 1-(2,2-diphenylethyl)piperidine-4-carboxylate |
| SMILES | O=C([O-])C1CCN(CC(c2ccccc2)c2ccccc2)CC1.[Li+] |
| InChI | InChI=1S/C20H23NO2.Li/c22-20(23)18-11-13-21(14-12-18)15-19(16-7-3-1-4-8-16)17-9-5-2-6-10-17;/h1-10,18-19H,11-15H2,(H,22,23);/q;+1/p-1 |
| InChIKey | IXKSFNZRFONHRW-UHFFFAOYSA-M |
| XLogP | -0.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |